Difference between revisions of "FMN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-HYDROXYMETHYLGLUTATHIONE == * common-name: ** s-(hydroxymethyl)glutathione * smiles: ** c(nc(=o)c(csco)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o...")
(Created page with "Category:metabolite == Metabolite Protein-Tyrosines == * common-name: ** a [protein]-l-tyrosine == Reaction(s) known to consume the compound == * 2.7.10.1-RXN == React...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-HYDROXYMETHYLGLUTATHIONE ==
+
== Metabolite Protein-Tyrosines ==
 
* common-name:
 
* common-name:
** s-(hydroxymethyl)glutathione
+
** a [protein]-l-tyrosine
* smiles:
 
** c(nc(=o)c(csco)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-]
 
* inchi-key:
 
** piuslwsyoyfrfr-bqbzgakwsa-m
 
* molecular-weight:
 
** 336.339
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2962]]
+
* [[2.7.10.1-RXN]]
* [[RXN0-276]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-276]]
+
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-(hydroxymethyl)glutathione}}
+
{{#set: common-name=a [protein]-l-tyrosine}}
{{#set: inchi-key=inchikey=piuslwsyoyfrfr-bqbzgakwsa-m}}
 
{{#set: molecular-weight=336.339}}
 

Revision as of 15:30, 5 January 2021

Metabolite Protein-Tyrosines

  • common-name:
    • a [protein]-l-tyrosine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-tyrosine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.