Difference between revisions of "FMN"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed-MG+2 TransportSeed-MG+2] == * direction: ** left-to-right == Reaction formula == * 1....") |
(Created page with "Category:metabolite == Metabolite FMN == * common-name: ** fmn * smiles: ** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3))) * inchi-key: *...") |
||
| (8 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite FMN == |
| − | * | + | * common-name: |
| − | ** | + | ** fmn |
| − | == Reaction | + | * smiles: |
| − | * | + | ** cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3))) |
| − | == | + | * inchi-key: |
| − | + | ** ankzybdxhmzbdk-scrdcrapsa-k | |
| − | + | * molecular-weight: | |
| − | * | + | ** 453.324 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | {{#set: | + | * [[FAD-PYROPHOSPHATASE-RXN]] |
| − | + | * [[FADSYN-RXN]] | |
| − | {{#set: | + | * [[RXN-9510]] |
| − | + | * [[RXN0-5187]] | |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | + | * [[ARPT]] | |
| − | + | * [[FAD-PYROPHOSPHATASE-RXN]] | |
| + | * [[RIBOFLAVINKIN-RXN]] | ||
| + | * [[RXN-9510]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=fmn}} | ||
| + | {{#set: inchi-key=inchikey=ankzybdxhmzbdk-scrdcrapsa-k}} | ||
| + | {{#set: molecular-weight=453.324}} | ||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite FMN
- common-name:
- fmn
- smiles:
- cc2(=cc1(n=c3(c(=o)[n-]c(=o)n=c(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)3)))
- inchi-key:
- ankzybdxhmzbdk-scrdcrapsa-k
- molecular-weight:
- 453.324
