Difference between revisions of "FMNH2"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01009 == * transcription-direction: ** positive * right-end-position: ** 81048 * left-end-position: ** 71004 * centisome-position: ** 44.793236...") |
(Created page with "Category:metabolite == Metabolite FMNH2 == * common-name: ** fmnh2 * smiles: ** cc2(=cc1(nc3(c(=o)nc(=o)nc(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)=3))) * inchi-key: *...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite FMNH2 == |
− | * | + | * common-name: |
− | ** | + | ** fmnh2 |
− | * | + | * smiles: |
− | ** | + | ** cc2(=cc1(nc3(c(=o)nc(=o)nc(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)=3))) |
− | * | + | * inchi-key: |
− | ** | + | ** ytnixzgthtvjbw-scrdcrapsa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 456.348 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-9510]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[RXN-9510]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=fmnh2}} | |
− | + | {{#set: inchi-key=inchikey=ytnixzgthtvjbw-scrdcrapsa-l}} | |
− | + | {{#set: molecular-weight=456.348}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite FMNH2
- common-name:
- fmnh2
- smiles:
- cc2(=cc1(nc3(c(=o)nc(=o)nc(n(cc(o)c(o)c(o)cop([o-])(=o)[o-])c=1c=c(c)2)=3)))
- inchi-key:
- ytnixzgthtvjbw-scrdcrapsa-l
- molecular-weight:
- 456.348