Difference between revisions of "FORMALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13575 == * common-name: ** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate * smiles: ** cc1(c(=ccop([o-])(=o)[o-])...")
(Created page with "Category:metabolite == Metabolite FORMALDEHYDE == * common-name: ** formaldehyde * smiles: ** [ch2]=o * inchi-key: ** wsfssnumvmoomr-uhfffaoysa-n * molecular-weight: ** 30...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13575 ==
+
== Metabolite FORMALDEHYDE ==
 
* common-name:
 
* common-name:
** 2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate
+
** formaldehyde
 
* smiles:
 
* smiles:
** cc1(c(=ccop([o-])(=o)[o-])sc(c(=o)[o-])n=1)
+
** [ch2]=o
 
* inchi-key:
 
* inchi-key:
** pqmcqnovnfnpfj-hyimlasbsa-k
+
** wsfssnumvmoomr-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 264.169
+
** 30.026
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12611]]
+
* [[KETOPANTOALDOLASE-RXN]]
 +
* [[METHANOL-DEHYDROGENASE-RXN]]
 +
* [[RXN-17811]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[THIAZOLSYN2-RXN]]
+
* [[KETOPANTOALDOLASE-RXN]]
 +
* [[METHANOL-DEHYDROGENASE-RXN]]
 +
* [[RXN-11057]]
 +
* [[RXN-12353]]
 +
* [[RXN-13186]]
 +
* [[RXN-14189]]
 +
* [[RXN-17811]]
 +
* [[RXN-8660]]
 +
* [[RXN-8661]]
 +
* [[RXN0-984]]
 +
* [[RXN0-985]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-[(2r,5z)-2-carboxy-4-methylthiazol-5(2h)-ylidene]ethyl phosphate}}
+
{{#set: common-name=formaldehyde}}
{{#set: inchi-key=inchikey=pqmcqnovnfnpfj-hyimlasbsa-k}}
+
{{#set: inchi-key=inchikey=wsfssnumvmoomr-uhfffaoysa-n}}
{{#set: molecular-weight=264.169}}
+
{{#set: molecular-weight=30.026}}

Latest revision as of 11:13, 18 March 2021

Metabolite FORMALDEHYDE

  • common-name:
    • formaldehyde
  • smiles:
    • [ch2]=o
  • inchi-key:
    • wsfssnumvmoomr-uhfffaoysa-n
  • molecular-weight:
    • 30.026

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality