Difference between revisions of "FORMALDEHYDE"

Latest revision as of 11:13, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CINNAMOYL-COA ==
+== Metabolite FORMALDEHYDE ==
 * common-name:
-** (e)-cinnamoyl-coa
+** formaldehyde
 * smiles:
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+** [ch2]=o
 * inchi-key:
-** jvnvhnhitfvwix-kzkudurgsa-j
+** wsfssnumvmoomr-uhfffaoysa-n
 * molecular-weight:
-** 893.648
+** 30.026
 == Reaction(s) known to consume the compound ==
-* [[RXN-7645]]
+* [[KETOPANTOALDOLASE-RXN]]
+* [[METHANOL-DEHYDROGENASE-RXN]]
+* [[RXN-17811]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-2001]]
+* [[KETOPANTOALDOLASE-RXN]]
+* [[METHANOL-DEHYDROGENASE-RXN]]
+* [[RXN-11057]]
+* [[RXN-12353]]
+* [[RXN-13186]]
+* [[RXN-14189]]
+* [[RXN-17811]]
+* [[RXN-8660]]
+* [[RXN-8661]]
+* [[RXN0-984]]
+* [[RXN0-985]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(e)-cinnamoyl-coa}}
+{{#set: common-name=formaldehyde}}
-{{#set: inchi-key=inchikey=jvnvhnhitfvwix-kzkudurgsa-j}}
+{{#set: inchi-key=inchikey=wsfssnumvmoomr-uhfffaoysa-n}}
-{{#set: molecular-weight=893.648}}
+{{#set: molecular-weight=30.026}}