Difference between revisions of "FORMALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CINNAMOYL-COA == * common-name: ** (e)-cinnamoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(...")
(Created page with "Category:metabolite == Metabolite CPD-9868 == * common-name: ** 3-(all-trans-nonaprenyl)benzene-1,2-diol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CINNAMOYL-COA ==
+
== Metabolite CPD-9868 ==
 
* common-name:
 
* common-name:
** (e)-cinnamoyl-coa
+
** 3-(all-trans-nonaprenyl)benzene-1,2-diol
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
* inchi-key:
** jvnvhnhitfvwix-kzkudurgsa-j
+
** pkyzmvivzpjxfm-xbvqzqhusa-n
 
* molecular-weight:
 
* molecular-weight:
** 893.648
+
** 723.176
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7645]]
+
* [[RXN-9240]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2001]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(e)-cinnamoyl-coa}}
+
{{#set: common-name=3-(all-trans-nonaprenyl)benzene-1,2-diol}}
{{#set: inchi-key=inchikey=jvnvhnhitfvwix-kzkudurgsa-j}}
+
{{#set: inchi-key=inchikey=pkyzmvivzpjxfm-xbvqzqhusa-n}}
{{#set: molecular-weight=893.648}}
+
{{#set: molecular-weight=723.176}}

Revision as of 13:09, 14 January 2021

Metabolite CPD-9868

  • common-name:
    • 3-(all-trans-nonaprenyl)benzene-1,2-diol
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c
  • inchi-key:
    • pkyzmvivzpjxfm-xbvqzqhusa-n
  • molecular-weight:
    • 723.176

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality