Difference between revisions of "FORMYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite IDP == * common-name: ** idp * smiles: ** c(op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** jpxzqm...") |
(Created page with "Category:metabolite == Metabolite FORMYL-COA == * common-name: ** formyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccs[ch]=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1...") |
||
(6 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite FORMYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** formyl-coa |
* smiles: | * smiles: | ||
− | ** c( | + | ** cc(c)(c(o)c(=o)nccc(=o)nccs[ch]=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** sxmokyxnaplncw-gorzovpnsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 791.513 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN66-475-CPD-14717//CPD-14719/FORMYL-COA.32.]] |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=formyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sxmokyxnaplncw-gorzovpnsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=791.513}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite FORMYL-COA
- common-name:
- formyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccs[ch]=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- sxmokyxnaplncw-gorzovpnsa-j
- molecular-weight:
- 791.513