Difference between revisions of "FORMYL-L-METHIONYL-PEPTIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-ALA-D-ALA == * common-name: ** d-alanyl-d-alanine * smiles: ** cc([n+])c(=o)nc(c)c([o-])=o * inchi-key: ** defjqiddeaulhb-qwwzwvqmsa-n...")
(Created page with "Category:metabolite == Metabolite FORMYL-L-METHIONYL-PEPTIDE == * common-name: ** a [protein] n-terminal-formyl-l-methionine == Reaction(s) known to consume the compound =...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-ALA-D-ALA ==
+
== Metabolite FORMYL-L-METHIONYL-PEPTIDE ==
 
* common-name:
 
* common-name:
** d-alanyl-d-alanine
+
** a [protein] n-terminal-formyl-l-methionine
* smiles:
 
** cc([n+])c(=o)nc(c)c([o-])=o
 
* inchi-key:
 
** defjqiddeaulhb-qwwzwvqmsa-n
 
* molecular-weight:
 
** 160.172
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.5.1.88-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DALADALALIG-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-alanyl-d-alanine}}
+
{{#set: common-name=a [protein] n-terminal-formyl-l-methionine}}
{{#set: inchi-key=inchikey=defjqiddeaulhb-qwwzwvqmsa-n}}
 
{{#set: molecular-weight=160.172}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite FORMYL-L-METHIONYL-PEPTIDE

  • common-name:
    • a [protein] n-terminal-formyl-l-methionine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein] n-terminal-formyl-l-methionine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.