Difference between revisions of "FORMYL-L-METHIONYL-PEPTIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18492 == * common-name: ** (2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o...")
(Created page with "Category:metabolite == Metabolite FORMYL-L-METHIONYL-PEPTIDE == * common-name: ** a [protein] n-terminal-formyl-l-methionine == Reaction(s) known to consume the compound =...")
 
(6 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18492 ==
+
== Metabolite FORMYL-L-METHIONYL-PEPTIDE ==
 
* common-name:
 
* common-name:
** (2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa
+
** a [protein] n-terminal-formyl-l-methionine
* smiles:
 
** cccccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** uyokhwfeuajfmg-uiyhdvlfsa-j
 
* molecular-weight:
 
** 1102.034
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17114]]
+
* [[3.5.1.88-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17113]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=a [protein] n-terminal-formyl-l-methionine}}
{{#set: inchi-key=inchikey=uyokhwfeuajfmg-uiyhdvlfsa-j}}
 
{{#set: molecular-weight=1102.034}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite FORMYL-L-METHIONYL-PEPTIDE

  • common-name:
    • a [protein] n-terminal-formyl-l-methionine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein] n-terminal-formyl-l-methionine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.