Difference between revisions of "FORMYL-L-METHIONYL-PEPTIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18204 RXN-18204] == * direction: ** reversible == Reaction formula == * 1 CPDQT-38[c] '''+'...")
(Created page with "Category:metabolite == Metabolite CPD-18492 == * common-name: ** (2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18204 RXN-18204] ==
+
== Metabolite CPD-18492 ==
* direction:
+
* common-name:
** reversible
+
** (2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa
== Reaction formula ==
+
* smiles:
* 1 [[CPDQT-38]][c] '''+''' 1 [[NAD]][c] '''<=>''' 1 [[CPD-19489]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
+
** cccccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ21291]]
+
** uyokhwfeuajfmg-uiyhdvlfsa-j
** Category: [[annotation]]
+
* molecular-weight:
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 1102.034
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
* [[PWYQT-4450]], aliphatic glucosinolate biosynthesis, side chain elongation cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWYQT-4450 PWYQT-4450]
+
* [[RXN-17114]]
** '''5''' reactions found over '''30''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
== Reconstruction information  ==
+
* [[RXN-17113]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
== External links  ==
+
{{#set: common-name=(2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa}}
{{#set: direction=reversible}}
+
{{#set: inchi-key=inchikey=uyokhwfeuajfmg-uiyhdvlfsa-j}}
{{#set: nb gene associated=1}}
+
{{#set: molecular-weight=1102.034}}
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite CPD-18492

  • common-name:
    • (2e,6z,9z,12z,15z,18z)-tetracosahexaenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=ccc=ccc=cccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • uyokhwfeuajfmg-uiyhdvlfsa-j
  • molecular-weight:
    • 1102.034

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality