Difference between revisions of "FORMYL-THF-GLU-N"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-2 == * common-name: ** (-)-methyl jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc(oc)=o) * inchi-key: ** gewdntwnsazudx-wqmvxfaesa-n *...")
(Created page with "Category:metabolite == Metabolite FORMYL-THF-GLU-N == * common-name: ** an n10-formyl-tetrahydrofolate == Reaction(s) known to consume the compound == * AICARTRANSFORM-R...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-2 ==
+
== Metabolite FORMYL-THF-GLU-N ==
 
* common-name:
 
* common-name:
** (-)-methyl jasmonate
+
** an n10-formyl-tetrahydrofolate
* smiles:
 
** ccc=ccc1(c(=o)ccc1cc(oc)=o)
 
* inchi-key:
 
** gewdntwnsazudx-wqmvxfaesa-n
 
* molecular-weight:
 
** 224.299
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10767]]
+
* [[AICARTRANSFORM-RXN]]
 +
* [[FORMATETHFLIG-RXN]]
 +
* [[FORMYLTHFDEFORMYL-RXN]]
 +
* [[FORMYLTHFGLUSYNTH-RXN]]
 +
* [[GART-RXN]]
 +
* [[METHENYLTHFCYCLOHYDRO-RXN]]
 +
* [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[AICARTRANSFORM-RXN]]
 +
* [[FORMATETHFLIG-RXN]]
 +
* [[FORMYLTHFGLUSYNTH-RXN]]
 +
* [[GART-RXN]]
 +
* [[METHENYLTHFCYCLOHYDRO-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(-)-methyl jasmonate}}
+
{{#set: common-name=an n10-formyl-tetrahydrofolate}}
{{#set: inchi-key=inchikey=gewdntwnsazudx-wqmvxfaesa-n}}
 
{{#set: molecular-weight=224.299}}
 

Latest revision as of 11:13, 18 March 2021