Difference between revisions of "FORMYL-THF-GLU-N"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Peptide-with-N-terminal-Aspartate == * common-name: ** a peptide with an n-terminal l-aspartate == Reaction(s) known to consume the compo...")
(Created page with "Category:metabolite == Metabolite CPD1F-2 == * common-name: ** (-)-methyl jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc(oc)=o) * inchi-key: ** gewdntwnsazudx-wqmvxfaesa-n *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Peptide-with-N-terminal-Aspartate ==
+
== Metabolite CPD1F-2 ==
 
* common-name:
 
* common-name:
** a peptide with an n-terminal l-aspartate
+
** (-)-methyl jasmonate
 +
* smiles:
 +
** ccc=ccc1(c(=o)ccc1cc(oc)=o)
 +
* inchi-key:
 +
** gewdntwnsazudx-wqmvxfaesa-n
 +
* molecular-weight:
 +
** 224.299
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.4.11.21-RXN]]
+
* [[RXN-10767]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a peptide with an n-terminal l-aspartate}}
+
{{#set: common-name=(-)-methyl jasmonate}}
 +
{{#set: inchi-key=inchikey=gewdntwnsazudx-wqmvxfaesa-n}}
 +
{{#set: molecular-weight=224.299}}

Revision as of 13:09, 14 January 2021

Metabolite CPD1F-2

  • common-name:
    • (-)-methyl jasmonate
  • smiles:
    • ccc=ccc1(c(=o)ccc1cc(oc)=o)
  • inchi-key:
    • gewdntwnsazudx-wqmvxfaesa-n
  • molecular-weight:
    • 224.299

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality