Difference between revisions of "FORMYL-THF-GLU-N"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-2 == * common-name: ** (-)-methyl jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc(oc)=o) * inchi-key: ** gewdntwnsazudx-wqmvxfaesa-n *...") |
(Created page with "Category:metabolite == Metabolite STRICTOSIDINE == * common-name: ** 3-α(s)-strictosidine * smiles: ** c=c[ch]4([ch](c[ch]3(c2(nc1(=cc=cc=c1c=2cc[n+]3))))c(c(=o)oc)=...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite STRICTOSIDINE == |
* common-name: | * common-name: | ||
− | ** ( | + | ** 3-α(s)-strictosidine |
* smiles: | * smiles: | ||
− | ** | + | ** c=c[ch]4([ch](c[ch]3(c2(nc1(=cc=cc=c1c=2cc[n+]3))))c(c(=o)oc)=coc4oc5(oc(c(c(c5o)o)o)co)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** xbamjztxgwptrm-awtfmmiesa-o |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 531.581 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[STRICTOSIDINE-SYNTHASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=( | + | {{#set: common-name=3-α(s)-strictosidine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xbamjztxgwptrm-awtfmmiesa-o}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=531.581}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite STRICTOSIDINE
- common-name:
- 3-α(s)-strictosidine
- smiles:
- c=c[ch]4([ch](c[ch]3(c2(nc1(=cc=cc=c1c=2cc[n+]3))))c(c(=o)oc)=coc4oc5(oc(c(c(c5o)o)o)co))
- inchi-key:
- xbamjztxgwptrm-awtfmmiesa-o
- molecular-weight:
- 531.581