Difference between revisions of "FRU"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18493 == * common-name: ** (3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(scc...")
(Created page with "Category:metabolite == Metabolite FRU == * common-name: ** d-fructose == Reaction(s) known to consume the compound == * SBTD_D2 == Reaction(s) known to produce the com...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18493 ==
+
== Metabolite FRU ==
 
* common-name:
 
* common-name:
** (3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa
+
** d-fructose
* smiles:
 
** cccccc=ccc=ccc=ccc=ccc=cccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** nneppynerzejee-vugypbmhsa-j
 
* molecular-weight:
 
** 1120.05
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[SBTD_D2]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17114]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3s)-hydroxy-(6z,9z,12z,15z,18z)-tetracosapentaenoyl-coa}}
+
{{#set: common-name=d-fructose}}
{{#set: inchi-key=inchikey=nneppynerzejee-vugypbmhsa-j}}
 
{{#set: molecular-weight=1120.05}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite FRU

  • common-name:
    • d-fructose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality