Difference between revisions of "FRU"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate * smiles: ** cc(=cccc(=c...")
(Created page with "Category:metabolite == Metabolite Beta-D-Galactosides == * common-name: ** a β-d-galactoside == Reaction(s) known to consume the compound == * 3.2.1.23-RXN == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE ==
+
== Metabolite Beta-D-Galactosides ==
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate
+
** a β-d-galactoside
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
 
* inchi-key:
 
** yszsvgfmajxgmq-fricuitqsa-m
 
* molecular-weight:
 
** 575.85
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3.2.1.23-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.1.1.114-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate}}
+
{{#set: common-name=a β-d-galactoside}}
{{#set: inchi-key=inchikey=yszsvgfmajxgmq-fricuitqsa-m}}
 
{{#set: molecular-weight=575.85}}
 

Revision as of 14:57, 5 January 2021

Metabolite Beta-D-Galactosides

  • common-name:
    • a β-d-galactoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality