Difference between revisions of "FRU1P"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04760 == * transcription-direction: ** negative * right-end-position: ** 85279 * left-end-position: ** 34616 * centisome-position: ** 34.100063...") |
(Created page with "Category:metabolite == Metabolite FRU1P == * common-name: ** β-d-fructofuranose 1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(cop([o-])([o-])=o)(o)o1) * inchi-key: ** rhk...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite FRU1P == |
− | * | + | * common-name: |
− | ** | + | ** β-d-fructofuranose 1-phosphate |
− | + | * smiles: | |
− | + | ** c(o)c1(c(o)c(o)c(cop([o-])([o-])=o)(o)o1) | |
− | + | * inchi-key: | |
− | * | + | ** rhkkzbwrnhgjez-arqdhwqxsa-l |
− | + | * molecular-weight: | |
− | ** | + | ** 258.121 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-8631]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=β-d-fructofuranose 1-phosphate}} | |
− | + | {{#set: inchi-key=inchikey=rhkkzbwrnhgjez-arqdhwqxsa-l}} | |
− | + | {{#set: molecular-weight=258.121}} | |
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite FRU1P
- common-name:
- β-d-fructofuranose 1-phosphate
- smiles:
- c(o)c1(c(o)c(o)c(cop([o-])([o-])=o)(o)o1)
- inchi-key:
- rhkkzbwrnhgjez-arqdhwqxsa-l
- molecular-weight:
- 258.121