Difference between revisions of "FRU1P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite IS30-Insertion-Sequences == * common-name: ** an insertion sequence element is30 == Reaction(s) known to consume the compound == * RXN0...") |
(Created page with "Category:metabolite == Metabolite FRU1P == * common-name: ** β-d-fructofuranose 1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(cop([o-])([o-])=o)(o)o1) * inchi-key: ** rhk...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite FRU1P == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-fructofuranose 1-phosphate |
| + | * smiles: | ||
| + | ** c(o)c1(c(o)c(o)c(cop([o-])([o-])=o)(o)o1) | ||
| + | * inchi-key: | ||
| + | ** rhkkzbwrnhgjez-arqdhwqxsa-l | ||
| + | * molecular-weight: | ||
| + | ** 258.121 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-8631]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-fructofuranose 1-phosphate}} |
| + | {{#set: inchi-key=inchikey=rhkkzbwrnhgjez-arqdhwqxsa-l}} | ||
| + | {{#set: molecular-weight=258.121}} | ||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite FRU1P
- common-name:
- β-d-fructofuranose 1-phosphate
- smiles:
- c(o)c1(c(o)c(o)c(cop([o-])([o-])=o)(o)o1)
- inchi-key:
- rhkkzbwrnhgjez-arqdhwqxsa-l
- molecular-weight:
- 258.121
