Difference between revisions of "FRUCTOSE-16-DIPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-L-Ser-or-L-Thr-L-Pro == * common-name: ** a protein containing an (l-serine/l-threonine)-l-proline motif == Reaction(s) known to...") |
(Created page with "Category:metabolite == Metabolite FRUCTOSE-16-DIPHOSPHATE == * common-name: ** β-d-fructose 1,6-bisphosphate * smiles: ** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite FRUCTOSE-16-DIPHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-fructose 1,6-bisphosphate |
| + | * smiles: | ||
| + | ** c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([o-])(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** rnbgygvwrkecfj-arqdhwqxsa-j | ||
| + | * molecular-weight: | ||
| + | ** 336.085 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[2.7. | + | * [[2.7.1.90-RXN]] |
| + | * [[F16ALDOLASE-RXN]] | ||
| + | * [[F16BDEPHOS-RXN]] | ||
| + | * [[FBA_]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[2.7. | + | * [[2.7.1.90-RXN]] |
| + | * [[6PFRUCTPHOS-RXN]] | ||
| + | * [[F16ALDOLASE-RXN]] | ||
| + | * [[FBA_]] | ||
| + | * [[PFK_]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-fructose 1,6-bisphosphate}} |
| + | {{#set: inchi-key=inchikey=rnbgygvwrkecfj-arqdhwqxsa-j}} | ||
| + | {{#set: molecular-weight=336.085}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite FRUCTOSE-16-DIPHOSPHATE
- common-name:
- β-d-fructose 1,6-bisphosphate
- smiles:
- c(c1(c(c(c(o1)(cop(=o)([o-])[o-])o)o)o))op([o-])(=o)[o-]
- inchi-key:
- rnbgygvwrkecfj-arqdhwqxsa-j
- molecular-weight:
- 336.085
