Difference between revisions of "FRUCTOSE-6P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-glutamyl-tRNAGln == * common-name: ** an l-glutamyl-[trnagln] == Reaction(s) known to consume the compound == * 6.3.5.7-RXN == Reac...")
(Created page with "Category:metabolite == Metabolite FRUCTOSE-6P == * common-name: ** β-d-fructofuranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1) * inchi-key:...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-glutamyl-tRNAGln ==
+
== Metabolite FRUCTOSE-6P ==
 
* common-name:
 
* common-name:
** an l-glutamyl-[trnagln]
+
** β-d-fructofuranose 6-phosphate
 +
* smiles:
 +
** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1)
 +
* inchi-key:
 +
** bgwgxpapygqalx-arqdhwqxsa-l
 +
* molecular-weight:
 +
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[6.3.5.7-RXN]]
+
* [[2.7.1.90-RXN]]
 +
* [[2TRANSKETO-RXN]]
 +
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 +
* [[6PFRUCTPHOS-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[MANNPDEHYDROG-RXN]]
 +
* [[MANNPISOM-RXN]]
 +
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 +
* [[PFK_]]
 +
* [[PGIA]]
 +
* [[PGIAh]]
 +
* [[PGIB]]
 +
* [[PGIBh]]
 +
* [[PGLUCISOM-RXN]]
 +
* [[RXN-14812]]
 +
* [[TRANSALDOL-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9386]]
+
* [[2.7.1.90-RXN]]
 +
* [[2TRANSKETO-RXN]]
 +
* [[3.1.3.46-RXN]]
 +
* [[F16BDEPHOS-RXN]]
 +
* [[FRUCTOKINASE-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[MANNPDEHYDROG-RXN]]
 +
* [[MANNPISOM-RXN]]
 +
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 +
* [[PGIA]]
 +
* [[PGIAh]]
 +
* [[PGIB]]
 +
* [[PGIBh]]
 +
* [[PGLUCISOM-RXN]]
 +
* [[RXN-14812]]
 +
* [[TRANSALDOL-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-glutamyl-[trnagln]}}
+
{{#set: common-name=β-d-fructofuranose 6-phosphate}}
 +
{{#set: inchi-key=inchikey=bgwgxpapygqalx-arqdhwqxsa-l}}
 +
{{#set: molecular-weight=258.121}}

Latest revision as of 11:17, 18 March 2021