Difference between revisions of "FRUCTOSE-6P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DUTNH DUTNH] == * direction: ** left-to-right * common-name: ** dutp nucleotidohydrolase == Reactio...")
(Created page with "Category:metabolite == Metabolite FRUCTOSE-6P == * common-name: ** β-d-fructofuranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1) * inchi-key:...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DUTNH DUTNH] ==
+
== Metabolite FRUCTOSE-6P ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** dutp nucleotidohydrolase
+
** β-d-fructofuranose 6-phosphate
== Reaction formula ==
+
* smiles:
* 1.0 [[DUTP]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[DUMP]][c] '''+''' 1.0 [[PPI]][c] '''+''' 1.0 [[PROTON]][c]
+
** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1)
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ12893]]
+
** bgwgxpapygqalx-arqdhwqxsa-l
** Category: [[orthology]]
+
* molecular-weight:
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 258.121
* Gene: [[SJ19894]]
+
== Reaction(s) known to consume the compound ==
** Category: [[orthology]]
+
* [[2.7.1.90-RXN]]
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[2TRANSKETO-RXN]]
== Pathway(s)  ==
+
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
== Reconstruction information  ==
+
* [[6PFRUCTPHOS-RXN]]
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
== External links  ==
+
* [[MANNPDEHYDROG-RXN]]
{{#set: direction=left-to-right}}
+
* [[MANNPISOM-RXN]]
{{#set: common-name=dutp nucleotidohydrolase}}
+
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
{{#set: nb gene associated=2}}
+
* [[PFK_]]
{{#set: nb pathway associated=0}}
+
* [[PGIA]]
{{#set: reconstruction category=orthology}}
+
* [[PGIAh]]
{{#set: reconstruction tool=pantograph}}
+
* [[PGIB]]
{{#set: reconstruction comment=n.a}}
+
* [[PGIBh]]
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
+
* [[PGLUCISOM-RXN]]
 +
* [[RXN-14812]]
 +
* [[TRANSALDOL-RXN]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[2.7.1.90-RXN]]
 +
* [[2TRANSKETO-RXN]]
 +
* [[3.1.3.46-RXN]]
 +
* [[F16BDEPHOS-RXN]]
 +
* [[FRUCTOKINASE-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[MANNPDEHYDROG-RXN]]
 +
* [[MANNPISOM-RXN]]
 +
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 +
* [[PGIA]]
 +
* [[PGIAh]]
 +
* [[PGIB]]
 +
* [[PGIBh]]
 +
* [[PGLUCISOM-RXN]]
 +
* [[RXN-14812]]
 +
* [[TRANSALDOL-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=β-d-fructofuranose 6-phosphate}}
 +
{{#set: inchi-key=inchikey=bgwgxpapygqalx-arqdhwqxsa-l}}
 +
{{#set: molecular-weight=258.121}}

Latest revision as of 11:17, 18 March 2021