Difference between revisions of "FRUCTOSE-6P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12777 RXN-12777] == * direction: ** left-to-right * common-name: ** 3-oxo-dihomo γ linole...")
(Created page with "Category:metabolite == Metabolite FRUCTOSE-6P == * common-name: ** β-d-fructofuranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1) * inchi-key:...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12777 RXN-12777] ==
+
== Metabolite FRUCTOSE-6P ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 3-oxo-dihomo γ linolenoyl-[acp] synthase
+
** β-d-fructofuranose 6-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.3.1 ec-2.3.1]
+
** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[GAMMA-LINOLENOYL-COA]][c] '''+''' 1 [[MALONYL-COA]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CPD-14404]][c]
+
** bgwgxpapygqalx-arqdhwqxsa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
== Pathway(s)  ==
+
** 258.121
−
* [[PWY-7592]], arachidonate biosynthesis III (6-desaturase, mammals): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7592 PWY-7592]
+
== Reaction(s) known to consume the compound ==
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
* [[2.7.1.90-RXN]]
−
* [[PWY-5353]], arachidonate biosynthesis I (6-desaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5353 PWY-5353]
+
* [[2TRANSKETO-RXN]]
−
** '''7''' reactions found over '''8''' reactions in the full pathway
+
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
−
== Reconstruction information  ==
+
* [[6PFRUCTPHOS-RXN]]
−
* category: [[gap-filling]]; source: [[gapfilling_solution_with_meneco_draft_medium]]; tool: [[meneco]]; comment: added for gapfilling
+
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
−
== External links  ==
+
* [[MANNPDEHYDROG-RXN]]
−
{{#set: direction=left-to-right}}
+
* [[MANNPISOM-RXN]]
−
{{#set: common-name=3-oxo-dihomo γ linolenoyl-[acp] synthase}}
+
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
−
{{#set: ec-number=ec-2.3.1}}
+
* [[PFK_]]
−
{{#set: nb gene associated=0}}
+
* [[PGIA]]
−
{{#set: nb pathway associated=2}}
+
* [[PGIAh]]
−
{{#set: reconstruction category=gap-filling}}
+
* [[PGIB]]
−
{{#set: reconstruction tool=meneco}}
+
* [[PGIBh]]
−
{{#set: reconstruction comment=added for gapfilling}}
+
* [[PGLUCISOM-RXN]]
−
{{#set: reconstruction source=gapfilling_solution_with_meneco_draft_medium}}
+
* [[RXN-14812]]
 +
* [[TRANSALDOL-RXN]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[2.7.1.90-RXN]]
 +
* [[2TRANSKETO-RXN]]
 +
* [[3.1.3.46-RXN]]
 +
* [[F16BDEPHOS-RXN]]
 +
* [[FRUCTOKINASE-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[MANNPDEHYDROG-RXN]]
 +
* [[MANNPISOM-RXN]]
 +
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 +
* [[PGIA]]
 +
* [[PGIAh]]
 +
* [[PGIB]]
 +
* [[PGIBh]]
 +
* [[PGLUCISOM-RXN]]
 +
* [[RXN-14812]]
 +
* [[TRANSALDOL-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=β-d-fructofuranose 6-phosphate}}
 +
{{#set: inchi-key=inchikey=bgwgxpapygqalx-arqdhwqxsa-l}}
 +
{{#set: molecular-weight=258.121}}

Latest revision as of 11:17, 18 March 2021

Metabolite FRUCTOSE-6P

  • common-name:
    • β-d-fructofuranose 6-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1)
  • inchi-key:
    • bgwgxpapygqalx-arqdhwqxsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=FRUCTOSE-6P&oldid=139682"