Difference between revisions of "FRUCTOSE-6P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SUCCCOASYN-RXN SUCCCOASYN-RXN] == * direction: ** reversible * common-name: ** succinyl-coa synthet...")
 
(Created page with "Category:metabolite == Metabolite FRUCTOSE-6P == * common-name: ** β-d-fructofuranose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1) * inchi-key:...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SUCCCOASYN-RXN SUCCCOASYN-RXN] ==
+
== Metabolite FRUCTOSE-6P ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** succinyl-coa synthetase
+
** β-d-fructofuranose 6-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/6.2.1.5 ec-6.2.1.5]
+
** c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1)
−
* synonymous:
+
* inchi-key:
−
** succinate thiokinase
+
** bgwgxpapygqalx-arqdhwqxsa-l
−
** succinyl coa synthesis
+
* molecular-weight:
−
== Reaction formula ==
+
** 258.121
−
* 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[SUC]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[SUC-COA]][c]
+
== Reaction(s) known to consume the compound ==
−
== Gene(s) associated with this reaction  ==
+
* [[2.7.1.90-RXN]]
−
* Gene: [[SJ21782]]
+
* [[2TRANSKETO-RXN]]
−
** Category: [[annotation]]
+
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[6PFRUCTPHOS-RXN]]
−
** Category: [[orthology]]
+
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[MANNPDEHYDROG-RXN]]
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[MANNPISOM-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
−
* Gene: [[SJ03269]]
+
* [[PFK_]]
−
** Category: [[annotation]]
+
* [[PGIA]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[PGIAh]]
−
** Category: [[orthology]]
+
* [[PGIB]]
−
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[PGIBh]]
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[PGLUCISOM-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-14812]]
−
== Pathway(s) ==
+
* [[TRANSALDOL-RXN]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to produce the compound ==
−
* [[P42-PWY]], incomplete reductive TCA cycle: [http://metacyc.org/META/NEW-IMAGE?object=P42-PWY P42-PWY]
+
* [[2.7.1.90-RXN]]
−
** '''5''' reactions found over '''7''' reactions in the full pathway
+
* [[2TRANSKETO-RXN]]
−
* [[PWY-5392]], reductive TCA cycle II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5392 PWY-5392]
+
* [[3.1.3.46-RXN]]
−
** '''6''' reactions found over '''12''' reactions in the full pathway
+
* [[F16BDEPHOS-RXN]]
−
* [[PWY-5690]], TCA cycle II (plants and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5690 PWY-5690]
+
* [[FRUCTOKINASE-RXN]]
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
−
* [[PWY66-398]], TCA cycle III (animals): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-398 PWY66-398]
+
* [[MANNPDEHYDROG-RXN]]
−
** '''10''' reactions found over '''11''' reactions in the full pathway
+
* [[MANNPISOM-RXN]]
−
* [[PWY-6969]], TCA cycle V (2-oxoglutarate:ferredoxin oxidoreductase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6969 PWY-6969]
+
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
−
** '''10''' reactions found over '''12''' reactions in the full pathway
+
* [[PGIA]]
−
* [[PWY-5913]], partial TCA cycle (obligate autotrophs): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913]
+
* [[PGIAh]]
−
** '''10''' reactions found over '''11''' reactions in the full pathway
+
* [[PGIB]]
−
* [[PWY-5538]], pyruvate fermentation to acetate VI: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5538 PWY-5538]
+
* [[PGIBh]]
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
* [[PGLUCISOM-RXN]]
−
* [[PWY-5537]], pyruvate fermentation to acetate V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5537 PWY-5537]
+
* [[RXN-14812]]
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
* [[TRANSALDOL-RXN]]
−
* [[TCA]], TCA cycle I (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=TCA TCA]
+
== Reaction(s) of unknown directionality ==
−
** '''9''' reactions found over '''10''' reactions in the full pathway
+
{{#set: common-name=&beta;-d-fructofuranose 6-phosphate}}
−
* [[P23-PWY]], reductive TCA cycle I: [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY]
+
{{#set: inchi-key=inchikey=bgwgxpapygqalx-arqdhwqxsa-l}}
−
** '''9''' reactions found over '''12''' reactions in the full pathway
+
{{#set: molecular-weight=258.121}}
−
* [[PWY-7384]], anaerobic energy metabolism (invertebrates, mitochondrial): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7384 PWY-7384]
 
−
** '''6''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-6728]], methylaspartate cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6728 PWY-6728]
 
−
** '''11''' reactions found over '''19''' reactions in the full pathway
 
−
</div>
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17664 17664]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00405 R00405]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/O28098 O28098]
 
−
** [http://www.uniprot.org/uniprot/P53594 P53594]
 
−
** [http://www.uniprot.org/uniprot/O28733 O28733]
 
−
** [http://www.uniprot.org/uniprot/P45101 P45101]
 
−
** [http://www.uniprot.org/uniprot/P45102 P45102]
 
−
** [http://www.uniprot.org/uniprot/Q9JUT0 Q9JUT0]
 
−
** [http://www.uniprot.org/uniprot/Q58643 Q58643]
 
−
** [http://www.uniprot.org/uniprot/O26663 O26663]
 
−
** [http://www.uniprot.org/uniprot/P80886 P80886]
 
−
** [http://www.uniprot.org/uniprot/Q9PHY1 Q9PHY1]
 
−
** [http://www.uniprot.org/uniprot/Q9JUS9 Q9JUS9]
 
−
** [http://www.uniprot.org/uniprot/P80865 P80865]
 
−
** [http://www.uniprot.org/uniprot/Q9PHY0 Q9PHY0]
 
−
** [http://www.uniprot.org/uniprot/O67729 O67729]
 
−
** [http://www.uniprot.org/uniprot/O67546 O67546]
 
−
** [http://www.uniprot.org/uniprot/P53593 P53593]
 
−
** [http://www.uniprot.org/uniprot/P0AGE9 P0AGE9]
 
−
** [http://www.uniprot.org/uniprot/P0A836 P0A836]
 
−
** [http://www.uniprot.org/uniprot/O82662 O82662]
 
−
</div>
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=succinyl-coa synthetase}}
 
−
{{#set: ec-number=ec-6.2.1.5}}
 
−
{{#set: synonymous=succinate thiokinase|succinyl coa synthesis}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=12}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_nannochloropsis_salina|output_pantograph_arabidopsis_thaliana|saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite FRUCTOSE-6P

  • common-name:
    • β-d-fructofuranose 6-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(co)(o)c(o)c(o)1)
  • inchi-key:
    • bgwgxpapygqalx-arqdhwqxsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=FRUCTOSE-6P&oldid=139682"