Difference between revisions of "FUCCAT-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-824 CPD-824] == * common-name: ** 5-guanidino-2-oxopentanoate * smiles: ** c(c(cccnc(=[n+])...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18380 CPD-18380] == * common-name: ** 1-myristoyl-2-palmitoleoyl phosphatidate * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-824 CPD-824] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18380 CPD-18380] ==
 
* common-name:
 
* common-name:
** 5-guanidino-2-oxopentanoate
+
** 1-myristoyl-2-palmitoleoyl phosphatidate
 
* smiles:
 
* smiles:
** c(c(cccnc(=[n+])n)=o)(=o)[o-]
+
** ccccccc=ccccccccc(=o)oc(coc(ccccccccccccc)=o)cop([o-])(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** arbhxjxxvvhmet-uhfffaoysa-n
+
** aldwdbnwditvid-xswvmqtgsa-l
 
* molecular-weight:
 
* molecular-weight:
** 173.171
+
** 616.814
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ARG-OXIDATION-RXN]]
+
* [[RXN-17019]]
 +
* [[RXN-17020]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-guanidino-2-oxopentanoate}}
+
{{#set: common-name=1-myristoyl-2-palmitoleoyl phosphatidate}}
{{#set: inchi-key=inchikey=arbhxjxxvvhmet-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=aldwdbnwditvid-xswvmqtgsa-l}}
{{#set: molecular-weight=173.171}}
+
{{#set: molecular-weight=616.814}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-18380

  • common-name:
    • 1-myristoyl-2-palmitoleoyl phosphatidate
  • smiles:
    • ccccccc=ccccccccc(=o)oc(coc(ccccccccccccc)=o)cop([o-])(=o)[o-]
  • inchi-key:
    • aldwdbnwditvid-xswvmqtgsa-l
  • molecular-weight:
    • 616.814

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality