Difference between revisions of "FUCCAT-PWY"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-824 CPD-824] ==
+== Pathway FUCCAT-PWY ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 5-guanidino-2-oxopentanoate
+** fucose degradation
-* smiles:
+== Reaction(s) found ==
-** c(c(cccnc(=[n+])n)=o)(=o)[o-]
+* [[RXN0-5298]]
-* inchi-key:
+== Reaction(s) not found ==
-** arbhxjxxvvhmet-uhfffaoysa-n
+* [NoneFUCISOM-RXN FUCISOM-RXN]
-* molecular-weight:
+* [NoneFUCPALDOL-RXN FUCPALDOL-RXN]
-** 173.171
+* [NoneFUCULOKIN-RXN FUCULOKIN-RXN]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=fucose degradation}}
-* [[ARG-OXIDATION-RXN]]
+{{#set: nb reaction found=1}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.25}}
-{{#set: common-name=5-guanidino-2-oxopentanoate}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=arbhxjxxvvhmet-uhfffaoysa-n}}
-{{#set: molecular-weight=173.171}}