Difference between revisions of "FUM"

Latest revision as of 11:18, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite AMINO-PARATHION ==
+== Metabolite FUM ==
 * common-name:
-** amino-parathion
+** fumarate
 * smiles:
-** ccop(oc1(c=cc(=cc=1)n))(occ)=s
+** c(c([o-])=o)=cc(=o)[o-]
 * inchi-key:
-** xizotxgjxstqdi-uhfffaoysa-n
+** vzcyooqtpochfl-owojbtedsa-l
 * molecular-weight:
-** 261.275
+** 114.057
 == Reaction(s) known to consume the compound ==
-* [[AMINOPARATHION-PHOSPHATASE-RXN]]
+* [[AIAL]]
+* [[AICARSYN-RXN]]
+* [[AMPSYN-RXN]]
+* [[ARGSUCCINLYA-RXN]]
+* [[FUMARATE-REDUCTASE-NADH-RXN]]
+* [[FUMHYDR-RXN]]
+* [[RXN-9772]]
+* [[SUCDH_LPAREN_q8_RPAREN_m]]
+* [[SUCFUMtmr]]
 == Reaction(s) known to produce the compound ==
+* [[AAL_LPAREN_fum_RPAREN_]]
+* [[AIAL]]
+* [[AICARSYN-RXN]]
+* [[AMPSYN-RXN]]
+* [[ARGSUCCINLYA-RXN]]
+* [[FUMARATE-REDUCTASE-NADH-RXN]]
+* [[FUMHYDR-RXN]]
+* [[RXN-10445]]
+* [[RXN-12070]]
+* [[RXN-14971]]
+* [[RXN-15378]]
+* [[RXN-22]]
+* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
+* [[SUCDH_LPAREN_q8_RPAREN_m]]
+* [[SUCDHm]]
+* [[SUCFUMtmr]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=amino-parathion}}
+{{#set: common-name=fumarate}}
-{{#set: inchi-key=inchikey=xizotxgjxstqdi-uhfffaoysa-n}}
+{{#set: inchi-key=inchikey=vzcyooqtpochfl-owojbtedsa-l}}
-{{#set: molecular-weight=261.275}}
+{{#set: molecular-weight=114.057}}