Difference between revisions of "FUM"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DGDP == * common-name: ** dgdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** cikg...") |
(Created page with "Category:metabolite == Metabolite Uracil20-in-tRNAs == * common-name: ** a uracil20 in trna == Reaction(s) known to consume the compound == * RXN-12456 == Reaction(s)...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Uracil20-in-tRNAs == |
* common-name: | * common-name: | ||
− | ** | + | ** a uracil20 in trna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-12456]] | |
− | |||
− | |||
− | |||
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a uracil20 in trna}} |
− | |||
− |
Revision as of 13:13, 14 January 2021
Contents
Metabolite Uracil20-in-tRNAs
- common-name:
- a uracil20 in trna