Difference between revisions of "Farnesylated-CAAX-proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-667 == * common-name: ** o-acetyl-l-homoserine * smiles: ** cc(occc(c([o-])=o)[n+])=o * inchi-key: ** fcxzbwsiaggpcb-yfkpbyrvsa-n * m...") |
(Created page with "Category:metabolite == Metabolite Farnesylated-CAAX-proteins == * common-name: ** a farnesylated protein that ends with a caax sequence == Reaction(s) known to consume the...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Farnesylated-CAAX-proteins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a farnesylated protein that ends with a caax sequence |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11698]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-17573]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a farnesylated protein that ends with a caax sequence}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Farnesylated-CAAX-proteins
- common-name:
- a farnesylated protein that ends with a caax sequence
