Difference between revisions of "Fe3-siderophores"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Decanoyl-ACPs == * common-name: ** a decanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9531 * RXN-9652 == Reac...") |
(Created page with "Category:metabolite == Metabolite ACRYLYL-COA == * common-name: ** acryloyl-coa * smiles: ** c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ACRYLYL-COA == |
* common-name: | * common-name: | ||
| − | ** | + | ** acryloyl-coa |
| + | * smiles: | ||
| + | ** c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
| + | * inchi-key: | ||
| + | ** poodsgumucvrtr-iexphmlfsa-j | ||
| + | * molecular-weight: | ||
| + | ** 817.551 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PPCOAOm]] |
| − | * [[RXN- | + | * [[RXN-6383]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PPCOAOm]] |
| − | * [[RXN- | + | * [[RXN-6383]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=acryloyl-coa}} |
| + | {{#set: inchi-key=inchikey=poodsgumucvrtr-iexphmlfsa-j}} | ||
| + | {{#set: molecular-weight=817.551}} | ||
Revision as of 11:14, 15 January 2021
Contents
Metabolite ACRYLYL-COA
- common-name:
- acryloyl-coa
- smiles:
- c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- poodsgumucvrtr-iexphmlfsa-j
- molecular-weight:
- 817.551
