Difference between revisions of "Fe3-siderophores"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACRYLYL-COA == * common-name: ** acryloyl-coa * smiles: ** c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o...")
(Created page with "Category:metabolite == Metabolite Fe3-siderophores == * common-name: ** an fe(iii)-siderophore == Reaction(s) known to consume the compound == * FERRIC-CHELATE-REDUCTASE...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACRYLYL-COA ==
+
== Metabolite Fe3-siderophores ==
 
* common-name:
 
* common-name:
** acryloyl-coa
+
** an fe(iii)-siderophore
* smiles:
 
** c=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** poodsgumucvrtr-iexphmlfsa-j
 
* molecular-weight:
 
** 817.551
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PPCOAOm]]
+
* [[FERRIC-CHELATE-REDUCTASE-RXN]]
* [[RXN-6383]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PPCOAOm]]
 
* [[RXN-6383]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=acryloyl-coa}}
+
{{#set: common-name=an fe(iii)-siderophore}}
{{#set: inchi-key=inchikey=poodsgumucvrtr-iexphmlfsa-j}}
 
{{#set: molecular-weight=817.551}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite Fe3-siderophores

  • common-name:
    • an fe(iii)-siderophore

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality