Difference between revisions of "Ferrihemoglobins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9406 == * common-name: ** (2s)-ethylmalonyl-coa * smiles: ** ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite Ferrihemoglobins == * common-name: ** a ferrihemoglobin == Reaction(s) known to consume the compound == * RXN-11195 == Reaction(s) kn...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9406 ==
+
== Metabolite Ferrihemoglobins ==
 
* common-name:
 
* common-name:
** (2s)-ethylmalonyl-coa
+
** a ferrihemoglobin
* smiles:
 
** ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
 
* inchi-key:
 
** vugzqvcbbbezqe-uqcjfraesa-i
 
* molecular-weight:
 
** 876.595
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13029]]
+
* [[RXN-11195]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13029]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2s)-ethylmalonyl-coa}}
+
{{#set: common-name=a ferrihemoglobin}}
{{#set: inchi-key=inchikey=vugzqvcbbbezqe-uqcjfraesa-i}}
 
{{#set: molecular-weight=876.595}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Ferrihemoglobins

  • common-name:
    • a ferrihemoglobin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality