Difference between revisions of "Ferrihemoglobins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14455 RXN-14455] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:metabolite == Metabolite ALPHA-GLC-6-P == * common-name: ** α-d-glucose 6-phosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** n...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14455 RXN-14455] ==
+
== Metabolite ALPHA-GLC-6-P ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** α-d-glucose 6-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.6.3.54 ec-3.6.3.54]
+
** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[CU+]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[CU+]][e] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
+
** nbschqhzlsjfnq-dvkngefbsa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ05686]]
+
** 258.121
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[G6PADH]]
−
* Gene: [[SJ03995]]
+
* [[G6PADHh]]
−
** Category: [[annotation]]
+
* [[G6PI]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
−
* Gene: [[SJ17633]]
+
* [[PGCM]]
−
** Category: [[annotation]]
+
* [[PGIA]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[PGIAh]]
−
* Gene: [[SJ00612]]
+
* [[PGMTh]]
−
** Category: [[annotation]]
+
* [[RXN-15312]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[UG6PGT]]
−
* Gene: [[SJ17631]]
+
* [[UG6PGTn]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[G6PI]]
−
== Pathway(s) ==
+
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
−
== Reconstruction information  ==
+
* [[PGCM]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[PGIA]]
−
== External links  ==
+
* [[PGIAh]]
−
{{#set: direction=left-to-right}}
+
* [[PGMTh]]
−
{{#set: ec-number=ec-3.6.3.54}}
+
== Reaction(s) of unknown directionality ==
−
{{#set: nb gene associated=5}}
+
{{#set: common-name=α-d-glucose 6-phosphate}}
−
{{#set: nb pathway associated=0}}
+
{{#set: inchi-key=inchikey=nbschqhzlsjfnq-dvkngefbsa-l}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular-weight=258.121}}
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:38, 18 December 2020

Metabolite ALPHA-GLC-6-P

  • common-name:
    • α-d-glucose 6-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • nbschqhzlsjfnq-dvkngefbsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Ferrihemoglobins&oldid=48532"