Difference between revisions of "Feruloyl-polysaccharides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15977 == * common-name: ** 1,2-dioleoylglycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(co)oc(cccccccc=ccccccccc)=o * inchi-key: ** a...") |
(Created page with "Category:metabolite == Metabolite Feruloyl-polysaccharides == * common-name: ** a feruloyl-polysaccharide == Reaction(s) known to consume the compound == * [[3.1.1.73-RXN]...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Feruloyl-polysaccharides == |
* common-name: | * common-name: | ||
− | ** | + | ** a feruloyl-polysaccharide |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[3.1.1.73-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a feruloyl-polysaccharide}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Feruloyl-polysaccharides
- common-name:
- a feruloyl-polysaccharide