Difference between revisions of "Feruloyl-polysaccharides"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ10256 == * transcription-direction: ** positive * right-end-position: ** 28737 * left-end-position: ** 27346 * centisome-position: ** 86.57907...") |
(Created page with "Category:metabolite == Metabolite CPD-15977 == * common-name: ** 1,2-dioleoylglycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(co)oc(cccccccc=ccccccccc)=o * inchi-key: ** a...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-15977 == |
− | * | + | * common-name: |
− | ** | + | ** 1,2-dioleoylglycerol |
− | * | + | * smiles: |
− | ** | + | ** ccccccccc=ccccccccc(=o)occ(co)oc(cccccccc=ccccccccc)=o |
− | * | + | * inchi-key: |
− | ** | + | ** afshuzfnmvjnkx-llwmboqksa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 620.995 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-15090]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=1,2-dioleoylglycerol}} | |
− | + | {{#set: inchi-key=inchikey=afshuzfnmvjnkx-llwmboqksa-n}} | |
− | + | {{#set: molecular-weight=620.995}} | |
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-15977
- common-name:
- 1,2-dioleoylglycerol
- smiles:
- ccccccccc=ccccccccc(=o)occ(co)oc(cccccccc=ccccccccc)=o
- inchi-key:
- afshuzfnmvjnkx-llwmboqksa-n
- molecular-weight:
- 620.995