Difference between revisions of "Feruloyl-polysaccharides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15977 == * common-name: ** 1,2-dioleoylglycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(co)oc(cccccccc=ccccccccc)=o * inchi-key: ** a...") |
(Created page with "Category:metabolite == Metabolite CPD-9460 == * common-name: ** oleanolate 3 β-d-glucuronoside * smiles: ** cc6(ccc5(ccc1(c(=cc[ch]2(c1(cc[ch]3(c2(ccc(c3(c)c)oc4(c(c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-9460 == |
* common-name: | * common-name: | ||
− | ** | + | ** oleanolate 3 β-d-glucuronoside |
* smiles: | * smiles: | ||
− | ** | + | ** cc6(ccc5(ccc1(c(=cc[ch]2(c1(cc[ch]3(c2(ccc(c3(c)c)oc4(c(c(c(c(o4)c(=o)[o-])o)o)o))c))c))[ch]5c6)c)c(=o)[o-])c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** iuchkmazawjnbj-rcyxvvtdsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 630.817 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-9000]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=oleanolate 3 β-d-glucuronoside}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=iuchkmazawjnbj-rcyxvvtdsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=630.817}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite CPD-9460
- common-name:
- oleanolate 3 β-d-glucuronoside
- smiles:
- cc6(ccc5(ccc1(c(=cc[ch]2(c1(cc[ch]3(c2(ccc(c3(c)c)oc4(c(c(c(c(o4)c(=o)[o-])o)o)o))c))c))[ch]5c6)c)c(=o)[o-])c
- inchi-key:
- iuchkmazawjnbj-rcyxvvtdsa-l
- molecular-weight:
- 630.817