Difference between revisions of "Fructose-BisPO4-Aldolase-Lysine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19339 == * common-name: ** α-d-sedoheptulopyranose 7-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(co)(o)o1) * inc...") |
(Created page with "Category:metabolite == Metabolite Fructose-BisPO4-Aldolase-Lysine == * common-name: ** [fructose-bisphosphate aldolase]-lysine == Reaction(s) known to consume the compound...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Fructose-BisPO4-Aldolase-Lysine == |
* common-name: | * common-name: | ||
| − | ** | + | ** [fructose-bisphosphate aldolase]-lysine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13588]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=[fructose-bisphosphate aldolase]-lysine}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite Fructose-BisPO4-Aldolase-Lysine
- common-name:
- [fructose-bisphosphate aldolase]-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "fructose-bisphosphate aldolase]-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
