Difference between revisions of "Fructose-BisPO4-Aldolase-Tri-Me-Lysine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 8-AMINO-7-OXONONANOATE == * common-name: ** 8-amino-7-oxononanoate * smiles: ** cc(c(cccccc([o-])=o)=o)[n+] * inchi-key: ** guahpajoxvyfo...") |
(Created page with "Category:metabolite == Metabolite Fructose-BisPO4-Aldolase-Tri-Me-Lysine == * common-name: ** a [fructose-bisphosphate aldolase]-n6, n6,n6-trimethyl-l-lysine == Reaction(s...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Fructose-BisPO4-Aldolase-Tri-Me-Lysine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [fructose-bisphosphate aldolase]-n6, n6,n6-trimethyl-l-lysine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13588]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [fructose-bisphosphate aldolase]-n6, n6,n6-trimethyl-l-lysine}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Fructose-BisPO4-Aldolase-Tri-Me-Lysine
- common-name:
- a [fructose-bisphosphate aldolase]-n6, n6,n6-trimethyl-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [fructose-bisphosphate aldolase]-n6, n6,n6-trimethyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
