Difference between revisions of "Fructose-BisPO4-Aldolase-Tri-Me-Lysine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-Galactosyl-12-diacyl-glycerols == * common-name: ** a 1,2-diacyl-3-o-(β-d-galactopyranosyl)-sn-glycerol == Reaction(s) known to co...") |
(Created page with "Category:metabolite == Metabolite L-1-LYSOPHOSPHATIDATE == * common-name: ** 1-oleyl-2-lyso-phosphatidate * smiles: ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o * inc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-1-LYSOPHOSPHATIDATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-oleyl-2-lyso-phosphatidate |
| + | * smiles: | ||
| + | ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o | ||
| + | * inchi-key: | ||
| + | ** wrgqswvcfniunz-gdckjwnlsa-l | ||
| + | * molecular-weight: | ||
| + | ** 434.509 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15043]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-15045]] |
| + | * [[RXN-15068]] | ||
| + | * [[RXN-15091]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-oleyl-2-lyso-phosphatidate}} |
| + | {{#set: inchi-key=inchikey=wrgqswvcfniunz-gdckjwnlsa-l}} | ||
| + | {{#set: molecular-weight=434.509}} | ||
Revision as of 13:08, 14 January 2021
Contents
Metabolite L-1-LYSOPHOSPHATIDATE
- common-name:
- 1-oleyl-2-lyso-phosphatidate
- smiles:
- ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o
- inchi-key:
- wrgqswvcfniunz-gdckjwnlsa-l
- molecular-weight:
- 434.509
