Difference between revisions of "Fructose-BisPO4-Aldolase-Tri-Me-Lysine"

Revision as of 18:53, 14 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite L-1-LYSOPHOSPHATIDATE ==
+== Metabolite SO3 ==
 * common-name:
-** 1-oleyl-2-lyso-phosphatidate
+** sulfite
 * smiles:
-** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)o
+** [o-]s([o-])=o
 * inchi-key:
-** wrgqswvcfniunz-gdckjwnlsa-l
+** lsnnmfcwukxfee-uhfffaoysa-l
 * molecular-weight:
-** 434.509
+** 80.058
 == Reaction(s) known to consume the compound ==
-* [[RXN-15043]]
+* [[1.8.4.8-RXN]]
+* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
+* [[FESO3OXI-RXN]]
+* [[RXN-1223]]
+* [[RXN-701]]
+* [[SULFITE-OXIDASE-RXN]]
+* [[SULFITE-REDUCT-RXN]]
+* [[SULFITE-REDUCTASE-FERREDOXIN-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-15045]]
+* [[1.8.4.8-RXN]]
-* [[RXN-15068]]
+* [[1.8.4.9-RXN]]
-* [[RXN-15091]]
+* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
+* [[FESO3OXI-RXN]]
+* [[RXN-12019]]
+* [[RXN-13161]]
+* [[RXN-701]]
+* [[RXN-9733]]
+* [[THIOSULFATE-SULFURTRANSFERASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1-oleyl-2-lyso-phosphatidate}}
+{{#set: common-name=sulfite}}
-{{#set: inchi-key=inchikey=wrgqswvcfniunz-gdckjwnlsa-l}}
+{{#set: inchi-key=inchikey=lsnnmfcwukxfee-uhfffaoysa-l}}
-{{#set: molecular-weight=434.509}}
+{{#set: molecular-weight=80.058}}