Difference between revisions of "G-5-prime-PP-5-prime-DNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8268 == * common-name: ** dioleoyl phosphatidate * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o *...") |
(Created page with "Category:metabolite == Metabolite G-5-prime-PP-5-prime-DNA == * common-name: ** guaosine-5'-diphospho-5'-[dna] == Reaction(s) known to consume the compound == * RXN-1792...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite G-5-prime-PP-5-prime-DNA == |
* common-name: | * common-name: | ||
− | ** | + | ** guaosine-5'-diphospho-5'-[dna] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-17923]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-17922]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=guaosine-5'-diphospho-5'-[dna]}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite G-5-prime-PP-5-prime-DNA
- common-name:
- guaosine-5'-diphospho-5'-[dna]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "guaosine-5'-diphospho-5'-[dna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.