Difference between revisions of "GALACTITOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-Acetyl-beta-D-Hexosaminides == * common-name: ** an n-acetyl-β-d-hexosaminide == Reaction(s) known to consume the compound == * ...") |
(Created page with "Category:metabolite == Metabolite CPD-14873 == * common-name: ** 3-amino-4-hydroxybenzoate * smiles: ** c(=o)([o-])c1(c=c(n)c(o)=cc=1) * inchi-key: ** mrbkrzapgucwos-uhfff...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14873 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-amino-4-hydroxybenzoate |
| + | * smiles: | ||
| + | ** c(=o)([o-])c1(c=c(n)c(o)=cc=1) | ||
| + | * inchi-key: | ||
| + | ** mrbkrzapgucwos-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 152.129 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-15414]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-amino-4-hydroxybenzoate}} |
| + | {{#set: inchi-key=inchikey=mrbkrzapgucwos-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=152.129}} | ||
Revision as of 18:57, 14 January 2021
Contents
Metabolite CPD-14873
- common-name:
- 3-amino-4-hydroxybenzoate
- smiles:
- c(=o)([o-])c1(c=c(n)c(o)=cc=1)
- inchi-key:
- mrbkrzapgucwos-uhfffaoysa-m
- molecular-weight:
- 152.129
