Difference between revisions of "GALACTOSE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03218 == * transcription-direction: ** positive * right-end-position: ** 111043 * left-end-position: ** 82690 * centisome-position: ** 67.08801...") |
(Created page with "Category:metabolite == Metabolite GALACTOSE == * common-name: ** β-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-fprjbgldsa-n * m...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite GALACTOSE == |
− | * | + | * common-name: |
− | ** | + | ** β-d-galactose |
− | * | + | * smiles: |
− | ** | + | ** c(o)c1(oc(o)c(o)c(o)c(o)1) |
− | * | + | * inchi-key: |
− | ** | + | ** wqzgkkkjijffok-fprjbgldsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 180.157 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[ALDOSE1EPIM-RXN]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | * [[ALDOSE1EPIM-RXN]] | |
− | * [[ | + | * [[BETAGALACTOSID-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=β-d-galactose}} | |
− | + | {{#set: inchi-key=inchikey=wqzgkkkjijffok-fprjbgldsa-n}} | |
− | + | {{#set: molecular-weight=180.157}} | |
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite GALACTOSE
- common-name:
- β-d-galactose
- smiles:
- c(o)c1(oc(o)c(o)c(o)c(o)1)
- inchi-key:
- wqzgkkkjijffok-fprjbgldsa-n
- molecular-weight:
- 180.157