Difference between revisions of "GALACTOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-GLUTAMATE-5-P == * common-name: ** γ-l-glutamyl 5-phosphate * smiles: ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite GALACTOSE == * common-name: ** β-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-fprjbgldsa-n * m...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GALACTOSE == |
* common-name: | * common-name: | ||
| − | ** & | + | ** β-d-galactose |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(o)c1(oc(o)c(o)c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wqzgkkkjijffok-fprjbgldsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 180.157 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ALDOSE1EPIM-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ALDOSE1EPIM-RXN]] |
| + | * [[BETAGALACTOSID-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=& | + | {{#set: common-name=β-d-galactose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wqzgkkkjijffok-fprjbgldsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.157}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite GALACTOSE
- common-name:
- β-d-galactose
- smiles:
- c(o)c1(oc(o)c(o)c(o)c(o)1)
- inchi-key:
- wqzgkkkjijffok-fprjbgldsa-n
- molecular-weight:
- 180.157
