Difference between revisions of "GALACTOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-GLUTAMATE-5-P == * common-name: ** γ-l-glutamyl 5-phosphate * smiles: ** c(ccc(c(=o)[o-])[n+])(op([o-])(=o)[o-])=o * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite Methyl-thioethers == * common-name: ** a methyl thioether == Reaction(s) known to consume the compound == == Reaction(s) known to produce...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Methyl-thioethers == |
* common-name: | * common-name: | ||
| − | ** | + | ** a methyl thioether |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[THIOL-S-METHYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a methyl thioether}} |
| − | |||
| − | |||
Revision as of 13:09, 14 January 2021
Contents
Metabolite Methyl-thioethers
- common-name:
- a methyl thioether
