Difference between revisions of "GALACTOSE-1P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CRPB-all-trans-Retinal == * common-name: ** an all-trans retinal-[cellular-retinol-binding-protein] == Reaction(s) known to consume the c...") |
(Created page with "Category:metabolite == Metabolite GALACTOSE-1P == * common-name: ** α-d-galactose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: **...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GALACTOSE-1P == |
* common-name: | * common-name: | ||
| − | ** | + | ** α-d-galactose 1-phosphate |
| + | * smiles: | ||
| + | ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) | ||
| + | * inchi-key: | ||
| + | ** hxxfsfrbohsimq-fprjbgldsa-l | ||
| + | * molecular-weight: | ||
| + | ** 258.121 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[GALACTOKIN-RXN]] | ||
| + | * [[GALACTURIDYLYLTRANS-RXN]] | ||
| + | * [[UTPHEXPURIDYLYLTRANS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[GALACTOKIN-RXN]] |
| + | * [[GALACTURIDYLYLTRANS-RXN]] | ||
| + | * [[UTPHEXPURIDYLYLTRANS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α-d-galactose 1-phosphate}} |
| + | {{#set: inchi-key=inchikey=hxxfsfrbohsimq-fprjbgldsa-l}} | ||
| + | {{#set: molecular-weight=258.121}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite GALACTOSE-1P
- common-name:
- α-d-galactose 1-phosphate
- smiles:
- c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
- inchi-key:
- hxxfsfrbohsimq-fprjbgldsa-l
- molecular-weight:
- 258.121
