Difference between revisions of "GALACTOSYLCERAMIDE-SULFATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THZ-P == * common-name: ** 4-methyl-5-(2-phosphooxyethyl)thiazole * smiles: ** cc1(n=csc(ccop([o-])(=o)[o-])=1) * inchi-key: ** ocymerzcm...") |
(Created page with "Category:metabolite == Metabolite CPD-3707 == * common-name: ** adenosine 2',3'-cyclic monophosphate * smiles: ** c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-3707 == |
* common-name: | * common-name: | ||
| − | ** | + | ** adenosine 2',3'-cyclic monophosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** kmywvddipvnlme-kqynxxcusa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 328.201 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12057]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=adenosine 2',3'-cyclic monophosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kmywvddipvnlme-kqynxxcusa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=328.201}} |
Revision as of 11:18, 15 January 2021
Contents
Metabolite CPD-3707
- common-name:
- adenosine 2',3'-cyclic monophosphate
- smiles:
- c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n))
- inchi-key:
- kmywvddipvnlme-kqynxxcusa-m
- molecular-weight:
- 328.201
