Difference between revisions of "GALACTOSYLCERAMIDE-SULFATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-3707 == * common-name: ** adenosine 2',3'-cyclic monophosphate * smiles: ** c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n)...")
(Created page with "Category:metabolite == Metabolite GALACTOSYLCERAMIDE-SULFATE == * common-name: ** a sulfatide == Reaction(s) known to consume the compound == == Reaction(s) known to produ...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-3707 ==
+
== Metabolite GALACTOSYLCERAMIDE-SULFATE ==
 
* common-name:
 
* common-name:
** adenosine 2',3'-cyclic monophosphate
+
** a sulfatide
* smiles:
 
** c4(n=c3(n(c1(c2(c(c(o1)co)op(o2)([o-])=o)))c=nc3=c(n=4)n))
 
* inchi-key:
 
** kmywvddipvnlme-kqynxxcusa-m
 
* molecular-weight:
 
** 328.201
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12057]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenosine 2',3'-cyclic monophosphate}}
+
{{#set: common-name=a sulfatide}}
{{#set: inchi-key=inchikey=kmywvddipvnlme-kqynxxcusa-m}}
 
{{#set: molecular-weight=328.201}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite GALACTOSYLCERAMIDE-SULFATE

  • common-name:
    • a sulfatide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality