Difference between revisions of "GALACTOSYLCERAMIDE-SULFATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-CHLORO-24-DINITROBENZENE == * common-name: ** 1-chloro-2,4-dinitrobenzene * smiles: ** c1(c=c(cl)c(=cc=1[n+]([o-])=o)[n+]([o-])=o) * in...") |
(Created page with "Category:metabolite == Metabolite HG0 == * common-name: ** hg0 * smiles: ** [hg] * inchi-key: ** qshddoujbyecft-uhfffaoysa-n * molecular-weight: ** 200.59 == Reaction(s) k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HG0 == |
* common-name: | * common-name: | ||
| − | ** | + | ** hg0 |
* smiles: | * smiles: | ||
| − | ** | + | ** [hg] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** qshddoujbyecft-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 200.59 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[MERCURY-II-REDUCTASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=hg0}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qshddoujbyecft-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=200.59}} |
Revision as of 13:12, 14 January 2021
Contents
Metabolite HG0
- common-name:
- hg0
- smiles:
- [hg]
- inchi-key:
- qshddoujbyecft-uhfffaoysa-n
- molecular-weight:
- 200.59
