Difference between revisions of "GALLATE-DEGRADATION-I-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Guanine1575-in-18StRNAs Guanine1575-in-18StRNAs] == * common-name: ** a guanine1575 in 18s trna...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == * common-name: ** l-cysteate * smiles: ** c(c([n+])c(=o)[o-])s(=o)(=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-cysteate |
| + | * smiles: | ||
| + | ** c(c([n+])c(=o)[o-])s(=o)(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** xvoyscvbglvsol-reohclbhsa-m | ||
| + | * molecular-weight: | ||
| + | ** 168.144 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11737]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11737]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-cysteate}} |
| + | {{#set: inchi-key=inchikey=xvoyscvbglvsol-reohclbhsa-m}} | ||
| + | {{#set: molecular-weight=168.144}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite L-CYSTEATE
- common-name:
- l-cysteate
- smiles:
- c(c([n+])c(=o)[o-])s(=o)(=o)[o-]
- inchi-key:
- xvoyscvbglvsol-reohclbhsa-m
- molecular-weight:
- 168.144
