Difference between revisions of "GAMA-TOCOPHEROL"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13886 == * transcription-direction: ** negative * right-end-position: ** 216282 * left-end-position: ** 213070 * centisome-position: ** 64.657974...") |
(Created page with "Category:metabolite == Metabolite GAMA-TOCOPHEROL == * common-name: ** γ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c)) * inchi-ke...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite GAMA-TOCOPHEROL == |
| − | * | + | * common-name: |
| − | ** | + | ** γ-tocopherol |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** quedxnhftdjviy-dqczwyhmsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 416.686 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=γ-tocopherol}} | |
| − | + | {{#set: inchi-key=inchikey=quedxnhftdjviy-dqczwyhmsa-n}} | |
| − | + | {{#set: molecular-weight=416.686}} | |
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite GAMA-TOCOPHEROL
- common-name:
- γ-tocopherol
- smiles:
- cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c))
- inchi-key:
- quedxnhftdjviy-dqczwyhmsa-n
- molecular-weight:
- 416.686
