Difference between revisions of "GAMA-TOCOPHEROL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9872 == * common-name: ** 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite CD-2S-SP-Complex == * common-name: ** a [cysteine desulfurase]-(s-sulfanyl)2-[disordered-form scaffold protein] complex == Reaction(s) kn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9872 ==
+
== Metabolite CD-2S-SP-Complex ==
 
* common-name:
 
* common-name:
** 6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol
+
** a [cysteine desulfurase]-(s-sulfanyl)2-[disordered-form scaffold protein] complex
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c)c)c)c)c
 
* inchi-key:
 
** glnrsjsltucxtp-iqsnhbbhsa-n
 
* molecular-weight:
 
** 767.229
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14387]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9242]]
+
* [[RXN-14386]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-nonaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=a [cysteine desulfurase]-(s-sulfanyl)2-[disordered-form scaffold protein] complex}}
{{#set: inchi-key=inchikey=glnrsjsltucxtp-iqsnhbbhsa-n}}
 
{{#set: molecular-weight=767.229}}
 

Revision as of 15:27, 5 January 2021

Metabolite CD-2S-SP-Complex

  • common-name:
    • a [cysteine desulfurase]-(s-sulfanyl)2-[disordered-form scaffold protein] complex

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [cysteine desulfurase]-(s-sulfanyl)2-[disordered-form scaffold protein] complex" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.